KRAS G12D inhibitor 5 structure
|
Common Name | KRAS G12D inhibitor 5 | ||
|---|---|---|---|---|
| CAS Number | 2621928-53-6 | Molecular Weight | 593.07 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H31ClF2N6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of KRAS G12D inhibitor 5KRAS G12D inhibitor 5 is a KRAS G12D inhibitor for the potential treatment of pancreatic cancer. |
| Name | KRAS G12D inhibitor 5 |
|---|
| Description | KRAS G12D inhibitor 5 is a KRAS G12D inhibitor for the potential treatment of pancreatic cancer. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C31H31ClF2N6O2 |
|---|---|
| Molecular Weight | 593.07 |
| InChIKey | MREIKMRVSAOCHR-RMIANRRMSA-N |
| SMILES | Oc1cc(-c2ncc3c(N4CC5CCC(C4)N5)nc(OCC45CCCN4CC(F)C5)nc3c2F)c2c(Cl)cccc2c1 |