(R)-2-Benzyl-3-(tert-Butoxycarbonylamino)propanoic acid structure
|
Common Name | (R)-2-Benzyl-3-(tert-Butoxycarbonylamino)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 262301-38-2 | Molecular Weight | 279.332 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 441.3±38.0 °C at 760 mmHg | |
| Molecular Formula | C15H21NO4 | Melting Point | 94-102ºC | |
| MSDS | Chinese USA | Flash Point | 220.7±26.8 °C | |
| Name | (2S)-2-Benzyl-3-[(tert-butoxycarbonyl)-amino]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 441.3±38.0 °C at 760 mmHg |
| Melting Point | 94-102ºC |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.332 |
| Flash Point | 220.7±26.8 °C |
| Exact Mass | 279.147064 |
| PSA | 75.63000 |
| LogP | 3.03 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.525 |
| InChIKey | ZYCITKXROAFBAR-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)NCC(Cc1ccccc1)C(=O)O |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36;R43 |
| Safety Phrases | S26-S36/37 |
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (R)-2-Benzyl-3-((tert-butoxycarbonyl)amino)propanoic acid |
| (R)-2-Benzyl-3-(tert-Butoxycarbonylamino)propanoic acid |