Pyrimidine,2-(methylthio)-4-(2-thienyl)-6-(trifluoromethyl)- structure
|
Common Name | Pyrimidine,2-(methylthio)-4-(2-thienyl)-6-(trifluoromethyl)- | ||
|---|---|---|---|---|
| CAS Number | 2627-53-4 | Molecular Weight | 276.30100 | |
| Density | 1.46g/cm3 | Boiling Point | 365.7ºC at 760 mmHg | |
| Molecular Formula | C10H7F3N2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175ºC | |
| Name | 2-methylsulfanyl-4-thiophen-2-yl-6-(trifluoromethyl)pyrimidine |
|---|
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 365.7ºC at 760 mmHg |
| Molecular Formula | C10H7F3N2S2 |
| Molecular Weight | 276.30100 |
| Flash Point | 175ºC |
| Exact Mass | 276.00000 |
| PSA | 79.32000 |
| LogP | 3.94580 |
| Vapour Pressure | 3.24E-05mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | JDPMXQFVFSMNLV-UHFFFAOYSA-N |
| SMILES | CSc1nc(-c2cccs2)cc(C(F)(F)F)n1 |
|
~59%
Pyrimidine,2-(m... CAS#:2627-53-4 |
| Literature: Melzig, Laurin; Metzger, Albrecht; Knochel, Paul Journal of Organic Chemistry, 2010 , vol. 75, # 6 p. 2131 - 2133 |
|
~%
Pyrimidine,2-(m... CAS#:2627-53-4 |
| Literature: Melzig, Laurin; Metzger, Albrecht; Knochel, Paul Chemistry - A European Journal, 2011 , vol. 17, # 10 p. 2948 - 2956 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |