2,4,5-t-1-octyl ester structure
|
Common Name | 2,4,5-t-1-octyl ester | ||
|---|---|---|---|---|
| CAS Number | 2630-15-1 | Molecular Weight | 367.69500 | |
| Density | 1.22g/cm3 | Boiling Point | 426.5ºC at 760mmHg | |
| Molecular Formula | C16H21Cl3O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 147.4ºC | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | octyl 2-(2,4,5-trichlorophenoxy)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 426.5ºC at 760mmHg |
| Molecular Formula | C16H21Cl3O3 |
| Molecular Weight | 367.69500 |
| Flash Point | 147.4ºC |
| Exact Mass | 366.05600 |
| PSA | 35.53000 |
| LogP | 5.92930 |
| Vapour Pressure | 1.76E-07mmHg at 25°C |
| Index of Refraction | 1.516 |
| InChIKey | VXWISAHTAQYMSH-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOC(=O)COc1cc(Cl)c(Cl)cc1Cl |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335-H410 |
| Precautionary Statements | P261-P273-P305 + P351 + P338-P501 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful;N: Dangerous for the environment; |
| Risk Phrases | 22-36/37/38-50/53 |
| Safety Phrases | 24-60-61 |
| RIDADR | UN3077 9/PG 3 |
| HS Code | 2918990090 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,4,5-T-1-octyl ester |
| Octyl (2,4,5-trichlorophenoxy)acetate |
| 2,4,5-T octyl ester |
| 2,4,5-Trichlorphenoxyessigsaeure-octylester |