promecarb structure
|
Common Name | promecarb | ||
|---|---|---|---|---|
| CAS Number | 2631-37-0 | Molecular Weight | 207.269 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 282.0±40.0 °C at 760 mmHg | |
| Molecular Formula | C12H17NO2 | Melting Point | 87-88ºC | |
| MSDS | Chinese USA | Flash Point | 124.3±27.3 °C | |
| Symbol |
GHS06, GHS09 |
Signal Word | Danger | |
| Name | promecarb |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 282.0±40.0 °C at 760 mmHg |
| Melting Point | 87-88ºC |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.269 |
| Flash Point | 124.3±27.3 °C |
| Exact Mass | 207.125931 |
| PSA | 38.33000 |
| LogP | 2.96 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.507 |
| InChIKey | DTAPQAJKAFRNJB-UHFFFAOYSA-N |
| SMILES | CNC(=O)Oc1cc(C)cc(C(C)C)c1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS06, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H300-H311-H410 |
| Precautionary Statements | Missing Phrase - N15.00950417-P280-P302 + P352 + P312 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T,N |
| Risk Phrases | R25 |
| Safety Phrases | S24-S37-S45-S60-S61 |
| RIDADR | 2757 |
| RTECS | FB8050000 |
| Packaging Group | II |
| Hazard Class | 6.1(a) |
| HS Code | 2924199090 |
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Microbial degradation of the carbamate pesticides desmedipham, phenmedipham, promecarb, and propamocarb.
Bull. Environ. Contam. Toxicol. 27(4) , 529-33, (1981)
|
|
|
Determination of the insecticide promecarb by fluorogenic labelling with dansyl chloride.
Analyst 116(8) , 851-6, (1991) The use of spectrofluorimetry to determine the fluorescent derivative of the insecticide promecarb, following hydrolysis to the corresponding phenol in basic media and subsequent coupling with the lab... |
|
|
Determination of N-methylcarbamate insecticides in water samples using dispersive liquid-liquid microextraction and HPLC with the aid of experimental design and desirability function.
Anal. Chim. Acta 699(1) , 113-9, (2011) A rapid and simple method for the extraction and preconcentration of N-methylcarbamates (NMCs) (carbofuran, carbaryl and promecarb) in water samples using dispersive liquid-liquid microextraction (DLL... |
| 3-methyl-5-(propan-2-yl)phenyl methylcarbamate |
| Promecarbe |
| Nor-Am |
| 3-methyl-5-isopropyl-phenyl methylcarbamate |
| Carbamult |
| Carbamic acid,methyl-,m-cym-5-yl ester |
| 5-methyl-m-cumenyl methylcarbamate |
| EINECS 220-113-0 |
| Morton EP-316 |
| MFCD00078728 |
| 1-Isopropyl-3-methyl-5-methylcarbamoyloxy-benzene |
| 3-methyl-5-i-propylphenyl N-methylcarbamate |
| Phenol, 3-methyl-5-(1-methylethyl)-, methylcarbamate |
| (3-methyl-5-propan-2-ylphenyl) N-methylcarbamate |
| 3-Isopropyl-5-methylphenyl methylcarbamate |
| Minacide |
| ITC |
| m-Cym-5-yl methylcarbamate |
| promecarb |
| 3-methyl-5-(1-methylethyl)phenyl N-methylcarbamate |