3-(1,1,2,2-Tetrafluoroethoxy)bromomethylbenzene
Modify Date: 2026-07-08 21:25:29
3-(1,1,2,2-Tetrafluoroethoxy)bromomethylbenzene structure
|
Common Name | 3-(1,1,2,2-Tetrafluoroethoxy)bromomethylbenzene | ||
|---|---|---|---|---|
| CAS Number | 263266-14-4 | Molecular Weight | 287.05 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7BrF4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(1,1,2,2-Tetrafluoroethoxy)bromomethylbenzene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H7BrF4O |
|---|---|
| Molecular Weight | 287.05 |
| InChIKey | RNJSNLDQQLNOFR-UHFFFAOYSA-N |
| SMILES | FC(F)C(F)(F)Oc1cccc(CBr)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3-(1,1,2,2-Tetrafluoroethoxy)bromomethylbenzene? |
| A: CAS number of 3-(1,1,2,2-Tetrafluoroethoxy)bromomethylbenzene is 263266-14-4. |
| Q: What is the SMILES notation of 3-(1,1,2,2-Tetrafluoroethoxy)bromomethylbenzene? |
| A: SMILES notation of 3-(1,1,2,2-Tetrafluoroethoxy)bromomethylbenzene is FC(F)C(F)(F)Oc1cccc(CBr)c1. |
| Q: What is the InChIKey of 3-(1,1,2,2-Tetrafluoroethoxy)bromomethylbenzene? |
| A: InChIKey of 3-(1,1,2,2-Tetrafluoroethoxy)bromomethylbenzene is RNJSNLDQQLNOFR-UHFFFAOYSA-N. |
| Q: What is the English name of 3-(1,1,2,2-Tetrafluoroethoxy)bromomethylbenzene? |
| A: The English name of 3-(1,1,2,2-Tetrafluoroethoxy)bromomethylbenzene is 3-(1,1,2,2-Tetrafluoroethoxy)bromomethylbenzene. |
| Q: What is the molecular weight of 3-(1,1,2,2-Tetrafluoroethoxy)bromomethylbenzene? |
| A: Molecular weight of 3-(1,1,2,2-Tetrafluoroethoxy)bromomethylbenzene is 287.05. |
| Q: What is the Chinese name of 263266-14-4? |
| A: Chinese name of 263266-14-4 is 263266-14-4. |
| Q: What is the molecular formula of 3-(1,1,2,2-Tetrafluoroethoxy)bromomethylbenzene? |
| A: Molecular formula of 3-(1,1,2,2-Tetrafluoroethoxy)bromomethylbenzene is C9H7BrF4O. |