4-Bromo-3-fluorobenzenesulfonamide structure
|
Common Name | 4-Bromo-3-fluorobenzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 263349-73-1 | Molecular Weight | 254.077 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 360.1±52.0 °C at 760 mmHg | |
| Molecular Formula | C6H5BrFNO2S | Melting Point | 137-141 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 171.6±30.7 °C | |
| Name | 4-Bromo-3-fluorobenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 360.1±52.0 °C at 760 mmHg |
| Melting Point | 137-141 °C(lit.) |
| Molecular Formula | C6H5BrFNO2S |
| Molecular Weight | 254.077 |
| Flash Point | 171.6±30.7 °C |
| Exact Mass | 252.920837 |
| PSA | 68.54000 |
| LogP | 1.69 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.593 |
| InChIKey | QTICZSSQSQDJEX-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1ccc(Br)c(F)c1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R22 |
| Safety Phrases | S22-S36/37 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Packaging Group | I |
| HS Code | 2935009090 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| Benzenesulfonamide, 4-bromo-3-fluoro- |
| MFCD03094292 |
| 4-Bromo-3-fluorobenzenesulfonamide |
| 4-bromo-3-fluoro-benzenesulfonamide |
| 4-Bromo-3-fluorobenzenesulphonamide |