Bz-Arg-OEt��HCl structure
|
Common Name | Bz-Arg-OEt��HCl | ||
|---|---|---|---|---|
| CAS Number | 2645-08-1 | Molecular Weight | 342.821 | |
| Density | 1.23g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H23ClN4O3 | Melting Point | 128-130 °C | |
| MSDS | USA | Flash Point | N/A | |
Use of Bz-Arg-OEt��HClN-Benzoyl-L-arginine ethyl ester hydrochloride is an arginine derivative[1]. |
| Name | Ethyl N-benzoyl-L-argininate hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | N-Benzoyl-L-arginine ethyl ester hydrochloride is an arginine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.23g/cm3 |
|---|---|
| Melting Point | 128-130 °C |
| Molecular Formula | C15H23ClN4O3 |
| Molecular Weight | 342.821 |
| Exact Mass | 342.145874 |
| PSA | 117.30000 |
| LogP | 2.99520 |
| Index of Refraction | -17 ° (C=2, H2O) |
| InChIKey | HIXDELXKSSLIKB-YDALLXLXSA-N |
| SMILES | CCOC(=O)C(CCCN=C(N)N)NC(=O)c1ccccc1.Cl |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R20/21/22 |
| Safety Phrases | S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2925290090 |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Mechanism of papain-catalyzed synthesis of oligo-tyrosine peptides.
Enzyme Microb. Technol. 75-76 , 10-7, (2015) Di-, tri-, and tetra-tyrosine peptides with angiotensin I-converting enzyme inhibitory activity were synthesized by papain-catalyzed polymerization of L-tyrosine ethyl ester in aqueous media at 30 °C.... |
|
|
Oxidative stress, neurotoxicity, and non-specific immune responses in juvenile red sea bream, Pagrus major, exposed to different waterborne selenium concentrations.
Chemosphere 135 , 46-52, (2015) Juvenile Pagrus major (mean length 15.8±1.6 cm, and mean weight 90.4±4.7 g) were exposed for 4 weeks with waterborne selenium concentration (0, 50, 100, 200, and 400 μg L(-1)). In oxidative stress ind... |
|
|
Immune activity of sweet potato (Ipomoea batatas L.) glycoprotein after enzymatic and chemical modifications.
Food Funct. 6 , 2026-32, (2015) This study aimed to investigate the immune activity of sweet potato (Ipomoea batatas L.) glycoprotein (SPG-1) before and after enzymatic and chemical modifications. The protein portion of SPG-1 was mo... |
| BZ-ARGININE-OET HCL |
| Bz-Arg-OEt��HCl |
| BAEE |
| Nalpha-Benzoyl-L-arginine ethyl ester hydrochloride |
| BENZOYL-ARG-OET HCL |
| BAEE HYDROCHLORIDE |
| BAEE,HCL |
| L-BAEE |
| Bz-Arg-OEt,HCl |
| Bz-Arg-OEt.HCl |
| hyl N-benzoyl-L-argi |
| Nα-Benzoyl-L-arginine Ethyl Ester Hydrochloride |
| Ethyl N-benzoyl-L-argininate hydrochloride (1:1) |
| L-Arginine, N-benzoyl-, ethyl ester, hydrochloride (1:1) |
| MFCD00012579 |
| Bz-Arg-Oet·Hcl |
| Bz-L-Arg-OEt*HCl |
| EINECS 220-157-0 |
| BZO-ARG-OET HCL |
| N-Benzoyl-L-Arginine ethyl ester hydrochloride |