1H-Imidazole-2-butanol,5-[2-(3,4-dimethoxyphenyl)ethyl]-4-methyl- structure
|
Common Name | 1H-Imidazole-2-butanol,5-[2-(3,4-dimethoxyphenyl)ethyl]-4-methyl- | ||
|---|---|---|---|---|
| CAS Number | 26482-10-0 | Molecular Weight | 318.41100 | |
| Density | 1.128g/cm3 | Boiling Point | 523.6ºC at 760 mmHg | |
| Molecular Formula | C18H26N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 270.5ºC | |
| Name | 4-[4-[2-(3,4-dimethoxyphenyl)ethyl]-5-methyl-1H-imidazol-2-yl]butan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.128g/cm3 |
|---|---|
| Boiling Point | 523.6ºC at 760 mmHg |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.41100 |
| Flash Point | 270.5ºC |
| Exact Mass | 318.19400 |
| PSA | 67.37000 |
| LogP | 2.83550 |
| Vapour Pressure | 8.58E-12mmHg at 25°C |
| Index of Refraction | 1.56 |
| InChIKey | RKGSIHJYOCYEOU-UHFFFAOYSA-N |
| SMILES | COc1ccc(CCc2nc(CCCCO)[nH]c2C)cc1OC |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Cypholophin |
| 4-[4-(3,4-dimethoxy-phenethyl)-5-methyl-1(3)H-imidazol-2-yl]-butan-1-ol |
| 4-{4-[2-(3,4-dimethoxyphenyl)ethyl]-5-methyl-1h-imidazol-2-yl}butan-1-ol |
| cypholophine |