4-butyl-4-chloro-1,2-diphenylpyrazolidine-3,5-dione
4-butyl-4-chloro-1,2-diphenylpyrazolidine-3,5-dione structure
|
Common Name | 4-butyl-4-chloro-1,2-diphenylpyrazolidine-3,5-dione | ||
|---|---|---|---|---|
| CAS Number | 26485-63-2 | Molecular Weight | 342.81900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H19ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-butyl-4-chloro-1,2-diphenylpyrazolidine-3,5-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H19ClN2O2 |
|---|---|
| Molecular Weight | 342.81900 |
| Exact Mass | 342.11400 |
| PSA | 40.62000 |
| LogP | 4.27920 |
| InChIKey | GQBATWYIDINDSD-UHFFFAOYSA-N |
| SMILES | CCCCC1(Cl)C(=O)N(c2ccccc2)N(c2ccccc2)C1=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
4-butyl-4-chlor... CAS#:26485-63-2 |
| Literature: Franchi Farmaco, Edizione Scientifica, 1955 , vol. 10, p. 628,630 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3,5-Pyrazolidinedione,4-butyl-4-chloro-1,2-diphenyl |
| benzonyl chloride |
| 4-butyl-4-chloro-1,2-diphenyl-pyrazolidine-3,5-dione |
| 4-Butyl-4-chlor-1,2-diphenyl-pyrazolidin-3,5-dion |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 26485-63-2? |
| A: Chinese name of 26485-63-2 is 26485-63-2. |
| Q: What is the LogP of 4-butyl-4-chloro-1,2-diphenylpyrazolidine-3,5-dione? |
| A: LogP of 4-butyl-4-chloro-1,2-diphenylpyrazolidine-3,5-dione is 4.27920. |
| Q: What is the English name of 4-butyl-4-chloro-1,2-diphenylpyrazolidine-3,5-dione? |
| A: The English name of 4-butyl-4-chloro-1,2-diphenylpyrazolidine-3,5-dione is 4-butyl-4-chloro-1,2-diphenylpyrazolidine-3,5-dione. |
| Q: What is the molecular formula of 4-butyl-4-chloro-1,2-diphenylpyrazolidine-3,5-dione? |
| A: Molecular formula of 4-butyl-4-chloro-1,2-diphenylpyrazolidine-3,5-dione is C19H19ClN2O2. |
| Q: What is the SMILES notation of 4-butyl-4-chloro-1,2-diphenylpyrazolidine-3,5-dione? |
| A: SMILES notation of 4-butyl-4-chloro-1,2-diphenylpyrazolidine-3,5-dione is CCCCC1(Cl)C(=O)N(c2ccccc2)N(c2ccccc2)C1=O. |
| Q: What is the polar surface area (PSA) of 4-butyl-4-chloro-1,2-diphenylpyrazolidine-3,5-dione? |
| A: Polar surface area (PSA) of 4-butyl-4-chloro-1,2-diphenylpyrazolidine-3,5-dione is 40.62000. |
| Q: What is the CAS number of 4-butyl-4-chloro-1,2-diphenylpyrazolidine-3,5-dione? |
| A: CAS number of 4-butyl-4-chloro-1,2-diphenylpyrazolidine-3,5-dione is 26485-63-2. |
| Q: What English synonyms does 4-butyl-4-chloro-1,2-diphenylpyrazolidine-3,5-dione have? |
| A: English synonyms of 4-butyl-4-chloro-1,2-diphenylpyrazolidine-3,5-dione: 3,5-Pyrazolidinedione,4-butyl-4-chloro-1,2-diphenyl, benzonyl chloride, 4-butyl-4-chloro-1,2-diphenyl-pyrazolidine-3,5-dione, 4-Butyl-4-chlor-1,2-diphenyl-pyrazolidin-3,5-dion. |
| Q: What is the molecular weight of 4-butyl-4-chloro-1,2-diphenylpyrazolidine-3,5-dione? |
| A: Molecular weight of 4-butyl-4-chloro-1,2-diphenylpyrazolidine-3,5-dione is 342.81900. |
| Q: What is the InChIKey of 4-butyl-4-chloro-1,2-diphenylpyrazolidine-3,5-dione? |
| A: InChIKey of 4-butyl-4-chloro-1,2-diphenylpyrazolidine-3,5-dione is GQBATWYIDINDSD-UHFFFAOYSA-N. |