1-(2,6-DIMETHYLPHENOXY)ACETONE structure
|
Common Name | 1-(2,6-DIMETHYLPHENOXY)ACETONE | ||
|---|---|---|---|---|
| CAS Number | 265126-44-1 | Molecular Weight | 282.33900 | |
| Density | 1.416g/cm3 | Boiling Point | 518.3ºC at 760mmHg | |
| Molecular Formula | C11H10N2O3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.3ºC | |
| Name | 1-[2-(pyridin-2-ylsulfonylmethyl)-1,3-thiazol-4-yl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.416g/cm3 |
|---|---|
| Boiling Point | 518.3ºC at 760mmHg |
| Molecular Formula | C11H10N2O3S2 |
| Molecular Weight | 282.33900 |
| Flash Point | 267.3ºC |
| Exact Mass | 282.01300 |
| PSA | 113.61000 |
| LogP | 2.79540 |
| Vapour Pressure | 7.58E-11mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | KHJRGSODEFTCFO-UHFFFAOYSA-N |
| SMILES | CC(=O)c1csc(CS(=O)(=O)c2ccccn2)n1 |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2934100090 |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| HMS566K07 |
| 1-{2-[(2-pyridylsulfonyl)methyl]-1,3-thiazol-4-yl}ethan-1-one |