2-chloro-N-[4-[4-[(2-chloroacetyl)amino]phenyl]phenyl]acetamide structure
|
Common Name | 2-chloro-N-[4-[4-[(2-chloroacetyl)amino]phenyl]phenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 2653-11-4 | Molecular Weight | 337.20100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-chloro-N-[4-[4-[(2-chloroacetyl)amino]phenyl]phenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H14Cl2N2O2 |
|---|---|
| Molecular Weight | 337.20100 |
| Exact Mass | 336.04300 |
| PSA | 58.20000 |
| LogP | 3.85420 |
| InChIKey | NCTYKYTWYJEFJW-UHFFFAOYSA-N |
| SMILES | O=C(CCl)Nc1ccc(-c2ccc(NC(=O)CCl)cc2)cc1 |
|
~%
2-chloro-N-[4-[... CAS#:2653-11-4 |
| Literature: Sen Gupta et al. Journal of the Indian Chemical Society, 1957 , vol. 34, p. 71 |
|
~%
2-chloro-N-[4-[... CAS#:2653-11-4 |
| Literature: Svetkin,Yu.V. J. Gen. Chem. USSR (Engl. Transl.), 1965 , vol. 35, # 5 p. 834 - 836,837 - 839 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N,N'-biphenyl-4,4'-diylbis(2-chloroacetamide) |
| 4,4'-bis-(2-chloro-acetylamino)-biphenyl |
| Bis-chloracetyl-benzidin |
| 4,4'-Bis-(chloroacetylamino)-biphenyl |
| N.N'-Bis-chloracetyl-benzidin |
| 2-chloro-N-{4-[4-(2-chloroacetylamino)phenyl]phenyl}acetamide |
| 4,4'-Bis-(2-chlor-acetylamino)-biphenyl |