2-acetyl-4-methyl-1-phenylpyrazolidin-3-one structure
|
Common Name | 2-acetyl-4-methyl-1-phenylpyrazolidin-3-one | ||
|---|---|---|---|---|
| CAS Number | 2655-48-3 | Molecular Weight | 218.25200 | |
| Density | 1.194g/cm3 | Boiling Point | 321.4ºC at 760mmHg | |
| Molecular Formula | C12H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.5ºC | |
| Name | 2-acetyl-4-methyl-1-phenylpyrazolidin-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.194g/cm3 |
|---|---|
| Boiling Point | 321.4ºC at 760mmHg |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.25200 |
| Flash Point | 134.5ºC |
| Exact Mass | 218.10600 |
| PSA | 40.62000 |
| LogP | 1.43570 |
| Vapour Pressure | 0.000299mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | BPNPRBBKUKZUCD-UHFFFAOYSA-N |
| SMILES | CC(=O)N1C(=O)C(C)CN1c1ccccc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Phenyl-2-acetyl-4-methyl-3-pyrazolidone |
| 1-Phenyl-2-acetyl-4-methyl-pyrazolidon-3 |
| 2-acetyl-4-methyl-1-phenyl-pyrazolidin-3-one |
| EINECS 220-184-8 |