Alisol B 23-acetate structure
|
Common Name | Alisol B 23-acetate | ||
|---|---|---|---|---|
| CAS Number | 26575-95-1 | Molecular Weight | 514.736 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 590.7±50.0 °C at 760 mmHg | |
| Molecular Formula | C32H50O5 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 179.9±23.6 °C | |
Use of Alisol B 23-acetateAlisol B 23-acetate, a natural triterpenoid, produces protective effects against EE-induced cholestasis, due to FXR-mediated gene regulation.IC50 Value:Target: Anti-hepatotoxic natural product. In vitro: Alisol-B 23-acetate has an effect on FXR activation in a dose-dependent manner using luciferase reporter assay in HepG2 cells [3].In vivo: In alisol B 23-acetate-treated mice, the changes in transporters and enzymes, as well as ameliorative liver histology were abrogated by FXR antagonist guggulsterone [1]. Alisol B 23-acetate treatment in a dose-dependent manner resulted in protection against hepatotoxicity induced by CCl4via FXR activation. Through FXR activation, alisol B 23-acetate promoted hepatocyte proliferation via an induction in hepatic levels of FoxM1b, Cyclin D1 and Cyclin B1. Alisol B 23-acetate also reduced hepatic bile acids through a decrease in hepatic uptake transporter Ntcp, bile acid synthetic enzymes Cyp7a1, Cyp8b1, and an increase in efflux transporter Bsep, Mrp2 expression. In addition, alisol B 23-acetate induced the expression of STAT3 phosphorylation, and STAT3 target genes Bcl-xl and SOCS3, resulting in decreased hepatocyte apoptosis [2]. |
| Name | [1-(3,3-dimethyloxiran-2-yl)-3-[(8S,10S,11S,14R)-11-hydroxy-4,4,8,10,14-pentamethyl-3-oxo-1,2,5,6,7,9,11,12,15,16-decahydrocyclopenta[a]phenanthren-17-yl]butyl] acetate |
|---|---|
| Synonym | More Synonyms |
| Description | Alisol B 23-acetate, a natural triterpenoid, produces protective effects against EE-induced cholestasis, due to FXR-mediated gene regulation.IC50 Value:Target: Anti-hepatotoxic natural product. In vitro: Alisol-B 23-acetate has an effect on FXR activation in a dose-dependent manner using luciferase reporter assay in HepG2 cells [3].In vivo: In alisol B 23-acetate-treated mice, the changes in transporters and enzymes, as well as ameliorative liver histology were abrogated by FXR antagonist guggulsterone [1]. Alisol B 23-acetate treatment in a dose-dependent manner resulted in protection against hepatotoxicity induced by CCl4via FXR activation. Through FXR activation, alisol B 23-acetate promoted hepatocyte proliferation via an induction in hepatic levels of FoxM1b, Cyclin D1 and Cyclin B1. Alisol B 23-acetate also reduced hepatic bile acids through a decrease in hepatic uptake transporter Ntcp, bile acid synthetic enzymes Cyp7a1, Cyp8b1, and an increase in efflux transporter Bsep, Mrp2 expression. In addition, alisol B 23-acetate induced the expression of STAT3 phosphorylation, and STAT3 target genes Bcl-xl and SOCS3, resulting in decreased hepatocyte apoptosis [2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 590.7±50.0 °C at 760 mmHg |
| Molecular Formula | C32H50O5 |
| Molecular Weight | 514.736 |
| Flash Point | 179.9±23.6 °C |
| Exact Mass | 514.365845 |
| PSA | 110.19000 |
| LogP | 5.64 |
| Vapour Pressure | 0.0±3.8 mmHg at 25°C |
| Index of Refraction | 1.542 |
| InChIKey | NLOAQXKIIGTTRE-CXWFPJGHSA-N |
| SMILES | CC(=O)OC(CC(C)C1=C2CC(O)C3C4(C)CCC(=O)C(C)(C)C4CCC3(C)C2(C)CC1)C1OC1(C)C |
| Storage condition | 2~8℃ |
|
Name: Transactivation of FXR (unknown origin) transfected in HepG2 cells co-expressing pBSE...
Source: ChEMBL
Target: Bile acid receptor
External Id: CHEMBL4408862
|
|
Name: Retention time of the compound by HPLC-MS analysis
Source: ChEMBL
Target: N/A
External Id: CHEMBL5352875
|
| 8alpha,9beta,14beta-Dammar-13(17)-en-3-one,24,25-epoxy-11beta,23-dihydroxy-,23-acetate,(23S,24R) |
| Alisol B 23-monoacetate |
| Alisol B monoacetate |
| (8α,9β,11β,14β,20R,23S,24R)-11-Hydroxy-3-oxo-24,25-epoxydammar-13(17)-en-23-yl acetate |
| Alisol B acetate |
| N1550 |
| Alisol-B-Monoacetat |
| Alisol B 23-acetate |
| AlisolB-23-acetate |
| 23-O-Acetylalisol B |
| (8α,9β,11β,14β,23S,24R)-11-Hydroxy-3-oxo-24,25-epoxydammar-13(17)-en-23-yl acetate |
| Alisol B (23-acetate) |