(4-AMINO-PIPERIDIN-1-YL)-(4-FLUORO-PHENYL)-METHANONEHYDROCHLORIDE structure
|
Common Name | (4-AMINO-PIPERIDIN-1-YL)-(4-FLUORO-PHENYL)-METHANONEHYDROCHLORIDE | ||
|---|---|---|---|---|
| CAS Number | 26586-40-3 | Molecular Weight | 217.30700 | |
| Density | 1.03g/cm3 | Boiling Point | 372.9ºC at 760mmHg | |
| Molecular Formula | C14H19NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.1ºC | |
| Name | 1-[4-(azepan-1-yl)phenyl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.03g/cm3 |
|---|---|
| Boiling Point | 372.9ºC at 760mmHg |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.30700 |
| Flash Point | 144.1ºC |
| Exact Mass | 217.14700 |
| PSA | 20.31000 |
| LogP | 3.33460 |
| Vapour Pressure | 9.28E-06mmHg at 25°C |
| Index of Refraction | 1.535 |
| InChIKey | DAGCDTAHALGDJT-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(N2CCCCCC2)cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933990090 |
|
~69%
(4-AMINO-PIPERI... CAS#:26586-40-3 |
| Literature: Watson, Andrew J. A.; Fairbanks, Antony J. European Journal of Organic Chemistry, 2013 , # 30 p. 6784 - 6788 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-acetyl-4-azaperhydroepinylbenzene |
| 1-(4-azepan-1-ylphenyl)ethanone |
| 4-Hexamethylenimino-acetophenon |
| 1-(4-(azepan-1-yl)ethanone) |
| 4'-(Perhydroazepin-1-yl)acetophenon |
| (4-Azepan-1-ylphenyl)ethan-1-one |
| 4-N-Hexamethylenimino-acetophenon |