3,11-Dichloro-6,11-dihydro-6-methyldibenzo[c,f][1,2]thiazepine 5,5-dioxide structure
|
Common Name | 3,11-Dichloro-6,11-dihydro-6-methyldibenzo[c,f][1,2]thiazepine 5,5-dioxide | ||
|---|---|---|---|---|
| CAS Number | 26638-66-4 | Molecular Weight | 328.214 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 445.3±55.0 °C at 760 mmHg | |
| Molecular Formula | C14H11Cl2NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.1±31.5 °C | |
| Name | 3,11-dichloro-6-methyl-11H-benzo[c][2,1]benzothiazepine 5,5-dioxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 445.3±55.0 °C at 760 mmHg |
| Molecular Formula | C14H11Cl2NO2S |
| Molecular Weight | 328.214 |
| Flash Point | 223.1±31.5 °C |
| Exact Mass | 326.988739 |
| PSA | 45.76000 |
| LogP | 2.57 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.687 |
| InChIKey | FHICZIHQHGRZLE-UHFFFAOYSA-N |
| SMILES | CN1c2ccccc2C(Cl)c2ccc(Cl)cc2S1(=O)=O |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~%
3,11-Dichloro-6... CAS#:26638-66-4 |
| Literature: Dhainaut, Alain; Regnier, Gilbert; Atassi, Ghanem; Pierre, Alain; Leonce, Stephane; et al. Journal of Medicinal Chemistry, 1992 , vol. 35, # 13 p. 2481 - 2496 |
|
~96%
3,11-Dichloro-6... CAS#:26638-66-4 |
| Literature: BIOPHORE INDIA PHARMACEUTICALS PVT. LTD.; RANGISETTY, Jagadeesh, Babu; PULLAGURLA, Manik, Reddy; BHUDETI, Rajesh Patent: WO2010/70667 A2, 2010 ; Location in patent: Page/Page column 5 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,11-Dichloro-6,11-dihydro-6-methyldibenzo[c,f][1,2]thiazepine 5,5-dioxide |
| 3,11-Dichloro-6-methyl-6,11-dihydrodibenzo[c,f][1,2]thiazepine 5,5-dioxide |
| Dibenzo[c,f][1,2]thiazepine, 3,11-dichloro-6,11-dihydro-6-methyl-, 5,5-dioxide |
| 3,11-dicarbomethoxy-hendec-3-enoic acid |
| 2-Decene-1,2,10-tricarboxylic acid,2,10-dimethyl ester |
| 3,11-Dichlor-6-methyl-6,11-dihydrodibenzo[c,f][1,2]thiazepin-5,5-dioxid |
| 3,11-dichloro-6,11-dihydro-6-methyl-5,5-dioxo-dibenzo[c,f][1,2]thiazepine |
| 5,8-dichloro-10,10-dioxo-11-methyl-5,11-dihydrodibenzo<c,f><1,2>thiazepine |
| 3,11-Dichloro-6,11-dihydro-5,5-dioxo-6-methyldibenzo[c.f][1,2]thiazepine |
| 3,11-Dicarbomethoxyundec-3-enoic acid |