Propanamide,3,3',3''-nitrilotris- structure
|
Common Name | Propanamide,3,3',3''-nitrilotris- | ||
|---|---|---|---|---|
| CAS Number | 2664-61-1 | Molecular Weight | 230.26400 | |
| Density | 1.233g/cm3 | Boiling Point | 634.3ºC at 760mmHg | |
| Molecular Formula | C9H18N4O3 | Melting Point | 183ºC | |
| MSDS | N/A | Flash Point | 337.4ºC | |
| Name | 3-[bis(3-amino-3-oxopropyl)amino]propanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.233g/cm3 |
|---|---|
| Boiling Point | 634.3ºC at 760mmHg |
| Melting Point | 183ºC |
| Molecular Formula | C9H18N4O3 |
| Molecular Weight | 230.26400 |
| Flash Point | 337.4ºC |
| Exact Mass | 230.13800 |
| PSA | 132.51000 |
| LogP | 0.01550 |
| Vapour Pressure | 5.41E-16mmHg at 25°C |
| Index of Refraction | 1.535 |
| InChIKey | RERXJGPPGMABOY-UHFFFAOYSA-N |
| SMILES | NC(=O)CCN(CCC(N)=O)CCC(N)=O |
|
~57%
Propanamide,3,3... CAS#:2664-61-1 |
| Literature: Hoveyda; Karunaratne, Veranja; Nichols, Christopher J.; Rettig, Steven J.; Stephens, Ashley K. W.; Orvig, Chris Canadian Journal of Chemistry, 1998 , vol. 76, # 4 p. 414 - 425 |
|
~%
Propanamide,3,3... CAS#:2664-61-1 |
| Literature: Morsch Monatshefte fuer Chemie, 1933 , vol. 63, p. 224,230,234 |
| 3,3',3''-nitrilo-tri-propionic acid triamide |
| WLN: ZV2N2VZ2VZ |
| 3,3',3''-Nitrilo-tri-propionsaeure-triamid |
| 3,3',3''-Nitrilotris(propionamide) |
| Propanamide,3,3',3''-nitrilotris |
| Nitrilotripropionamide |
| 3,3',3''-nitrilotrispropionamide |