Salirepin structure
|
Common Name | Salirepin | ||
|---|---|---|---|---|
| CAS Number | 26652-12-0 | Molecular Weight | 302.28 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 633.2±55.0 °C at 760 mmHg | |
| Molecular Formula | C13H18O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 336.8±31.5 °C | |
Use of SalirepinSalirepin is a phenolic glycoside from fruits of Idesia polycarpa, inhibits LPS-induced nitric oxide production[1]. |
| Name | 4-Hydroxy-2-(hydroxymethyl)phenyl β-D-glucopyranoside |
|---|---|
| Synonym | More Synonyms |
| Description | Salirepin is a phenolic glycoside from fruits of Idesia polycarpa, inhibits LPS-induced nitric oxide production[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 633.2±55.0 °C at 760 mmHg |
| Molecular Formula | C13H18O8 |
| Molecular Weight | 302.28 |
| Flash Point | 336.8±31.5 °C |
| Exact Mass | 302.100159 |
| PSA | 139.84000 |
| LogP | -2.53 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.667 |
| InChIKey | NPNFZOGKIFFKGT-UJPOAAIJSA-N |
| SMILES | OCc1cc(O)ccc1OC1OC(CO)C(O)C(O)C1O |
| Hazard Codes | Xi |
|---|
| 1-Methyl-4-hydroxy-4-piperidyl-phenylketon |
| 1-Methyl-4-benzoyl-4-piperidinol |
| <4-Hydroxy-2,6-dimethoxy-phenyl>-aceton |
| β-D-Glucopyranoside, 4-hydroxy-2-(hydroxymethyl)phenyl |
| 4-Hydroxy-2-(hydroxymethyl)phenyl β-D-glucopyranoside |