2-chloro-N-(2-chlorophenyl)benzamide structure
|
Common Name | 2-chloro-N-(2-chlorophenyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 2670-39-5 | Molecular Weight | 266.12300 | |
| Density | 1.384g/cm3 | Boiling Point | 312.4ºC at 760 mmHg | |
| Molecular Formula | C13H9Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142.7ºC | |
| Name | 2-Chloro-N-p-tolyl-benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.384g/cm3 |
|---|---|
| Boiling Point | 312.4ºC at 760 mmHg |
| Molecular Formula | C13H9Cl2NO |
| Molecular Weight | 266.12300 |
| Flash Point | 142.7ºC |
| Exact Mass | 265.00600 |
| PSA | 29.10000 |
| LogP | 4.31870 |
| Vapour Pressure | 0.000531mmHg at 25°C |
| Index of Refraction | 1.656 |
| InChIKey | NIQANWYLZAOWCD-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1Cl)c1ccccc1Cl |
| HS Code | 2924299090 |
|---|
|
~%
2-chloro-N-(2-c... CAS#:2670-39-5 |
| Literature: Gowda, B. Thimme; Jyothi; Jayalakshmi; Damodara Journal of the Indian Chemical Society, 2005 , vol. 82, # 6 p. 564 - 568 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-chloro-N-(4-tolyl)benzamide |
| 2-chloro-benzoic acid-(2-chloro-anilide) |
| 2-chloro-benzoic acid p-toluidide |
| N-(2-chlorophenyl)-2-chlorobenzamide |
| 2-Chlor-benzoesaeure-p-toluidid |
| 2-Chlor-benzoesaeure-(2-chlor-anilid) |