5-amino-2-(phenoxy)benzotrifluoride structure
|
Common Name | 5-amino-2-(phenoxy)benzotrifluoride | ||
|---|---|---|---|---|
| CAS Number | 267416-81-9 | Molecular Weight | 253.22000 | |
| Density | 1.293g/cm3 | Boiling Point | 311.7ºC at 760mmHg | |
| Molecular Formula | C13H10F3NO | Melting Point | 55-57ºC | |
| MSDS | N/A | Flash Point | 142.3ºC | |
| Name | 4-phenoxy-3-(trifluoromethyl)aniline |
|---|
| Density | 1.293g/cm3 |
|---|---|
| Boiling Point | 311.7ºC at 760mmHg |
| Melting Point | 55-57ºC |
| Molecular Formula | C13H10F3NO |
| Molecular Weight | 253.22000 |
| Flash Point | 142.3ºC |
| Exact Mass | 253.07100 |
| PSA | 35.25000 |
| LogP | 4.66110 |
| Vapour Pressure | 0.000555mmHg at 25°C |
| Index of Refraction | 1.545 |
| InChIKey | GLVOXGPMYXJKGS-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Oc2ccccc2)c(C(F)(F)F)c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2922299090 |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |