Methyl 8-bromo-4-hydroxy-5-isopropoxy-2-naphthoate structure
|
Common Name | Methyl 8-bromo-4-hydroxy-5-isopropoxy-2-naphthoate | ||
|---|---|---|---|---|
| CAS Number | 267881-57-2 | Molecular Weight | 339.18100 | |
| Density | 1.452g/cm3 | Boiling Point | 483.7ºC at 760 mmHg | |
| Molecular Formula | C15H15BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.3ºC | |
| Name | Methyl 8-bromo-4-hydroxy-5-isopropoxy-2-naphthoate |
|---|
| Density | 1.452g/cm3 |
|---|---|
| Boiling Point | 483.7ºC at 760 mmHg |
| Molecular Formula | C15H15BrO4 |
| Molecular Weight | 339.18100 |
| Flash Point | 246.3ºC |
| Exact Mass | 338.01500 |
| PSA | 55.76000 |
| LogP | 3.88170 |
| Vapour Pressure | 5.59E-10mmHg at 25°C |
| Index of Refraction | 1.613 |
| InChIKey | LIWNETMLJBSSBB-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(O)c2c(OC(C)C)ccc(Br)c2c1 |
|
~95%
Methyl 8-bromo-... CAS#:267881-57-2 |
| Literature: De Koning, Charles B.; Michael, Joseph P.; Van Otterlo, Willem A.L. Journal of the Chemical Society, Perkin Transactions 1, 2000 , # 5 p. 799 - 811 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |