Methyl 8-bromo-4,5,6-trimethoxy-2-naphthoate structure
|
Common Name | Methyl 8-bromo-4,5,6-trimethoxy-2-naphthoate | ||
|---|---|---|---|---|
| CAS Number | 4147-32-4 | Molecular Weight | 355.18100 | |
| Density | 1.422g/cm3 | Boiling Point | 448.2ºC at 760 mmHg | |
| Molecular Formula | C15H15BrO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.9ºC | |
| Name | Methyl 8-bromo-4,5,6-trimethoxy-2-naphthoate |
|---|
| Density | 1.422g/cm3 |
|---|---|
| Boiling Point | 448.2ºC at 760 mmHg |
| Molecular Formula | C15H15BrO5 |
| Molecular Weight | 355.18100 |
| Flash Point | 224.9ºC |
| Exact Mass | 354.01000 |
| PSA | 53.99000 |
| LogP | 3.41470 |
| Index of Refraction | 1.584 |
| InChIKey | QPEJEAJPJGLARX-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(OC)c2c(OC)c(OC)cc(Br)c2c1 |
|
~%
Methyl 8-bromo-... CAS#:4147-32-4 |
| Literature: Brown,A.G.; Thomson,R.H. Journal of the Chemical Society, 1965 , p. 4292 - 4295 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |