3,4,5,2',4'-Pentahydroxychalcone structure
|
Common Name | 3,4,5,2',4'-Pentahydroxychalcone | ||
|---|---|---|---|---|
| CAS Number | 2679-65-4 | Molecular Weight | 288.252 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 658.1±55.0 °C at 760 mmHg | |
| Molecular Formula | C15H12O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 365.8±28.0 °C | |
Use of 3,4,5,2',4'-PentahydroxychalconeRobtein is a flavone that can be isolated from Robinia pseudoacacia[1]. |
| Name | (E)-1-(2,4-dihydroxyphenyl)-3-(3,4,5-trihydroxyphenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Description | Robtein is a flavone that can be isolated from Robinia pseudoacacia[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 658.1±55.0 °C at 760 mmHg |
| Molecular Formula | C15H12O6 |
| Molecular Weight | 288.252 |
| Flash Point | 365.8±28.0 °C |
| Exact Mass | 288.063385 |
| PSA | 118.22000 |
| LogP | 2.22 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
| Index of Refraction | 1.782 |
| InChIKey | NLAXFZHJXUCLDR-DAFODLJHSA-N |
| SMILES | O=C(C=Cc1cc(O)c(O)c(O)c1)c1ccc(O)cc1O |
| Hazard Codes | Xi |
|---|
| 2-Propen-1-one, 1-(2,4-dihydroxyphenyl)-3-(3,4,5-trihydroxyphenyl)-, (2E)- |
| (2E)-1-(2,4-Dihydroxyphenyl)-3-(3,4,5-trihydroxyphenyl)-2-propen-1-one |
| 3,4,5,2',4'-Pentahydroxy-trans-chalkon |
| 2',3,4,4',5-Pentahydroxychalcone |
| 3,4,5,2',4'-Pentahydroxychalcone |
| 3,4,5,2',4'-pentahydroxy-trans-chalcone |
| Robtein |