5-Methyl-5'-(2,2,2-trifluoroacetamido)-[2,3'-bithiophene]-4'-carboxylic acid
Modify Date: 2026-08-03 09:26:32
![5-Methyl-5'-(2,2,2-trifluoroacetamido)-[2,3'-bithiophene]-4'-carboxylic acid Structure](https://www.chemsrc.com/extcaspic/215/2680803-77-2.png)
5-Methyl-5'-(2,2,2-trifluoroacetamido)-[2,3'-bithiophene]-4'-carboxylic acid structure
|
Common Name | 5-Methyl-5'-(2,2,2-trifluoroacetamido)-[2,3'-bithiophene]-4'-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 2680803-77-2 | Molecular Weight | 335.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8F3NO3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Methyl-5'-(2,2,2-trifluoroacetamido)-[2,3'-bithiophene]-4'-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H8F3NO3S2 |
|---|---|
| Molecular Weight | 335.3 |
| InChIKey | IXSLAJDOTLTMBX-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2csc(NC(=O)C(F)(F)F)c2C(=O)O)s1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 5-Methyl-5'-(2,2,2-trifluoroacetamido)-[2,3'-bithiophene]-4'-carboxylic acid? |
| A: CAS number of 5-Methyl-5'-(2,2,2-trifluoroacetamido)-[2,3'-bithiophene]-4'-carboxylic acid is 2680803-77-2. |
| Q: What is the English name of 5-Methyl-5'-(2,2,2-trifluoroacetamido)-[2,3'-bithiophene]-4'-carboxylic acid? |
| A: The English name of 5-Methyl-5'-(2,2,2-trifluoroacetamido)-[2,3'-bithiophene]-4'-carboxylic acid is 5-Methyl-5'-(2,2,2-trifluoroacetamido)-[2,3'-bithiophene]-4'-carboxylic acid. |
| Q: What is the InChIKey of 5-Methyl-5'-(2,2,2-trifluoroacetamido)-[2,3'-bithiophene]-4'-carboxylic acid? |
| A: InChIKey of 5-Methyl-5'-(2,2,2-trifluoroacetamido)-[2,3'-bithiophene]-4'-carboxylic acid is IXSLAJDOTLTMBX-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2680803-77-2? |
| A: Chinese name of 2680803-77-2 is 2680803-77-2. |
| Q: What is the SMILES notation of 5-Methyl-5'-(2,2,2-trifluoroacetamido)-[2,3'-bithiophene]-4'-carboxylic acid? |
| A: SMILES notation of 5-Methyl-5'-(2,2,2-trifluoroacetamido)-[2,3'-bithiophene]-4'-carboxylic acid is Cc1ccc(-c2csc(NC(=O)C(F)(F)F)c2C(=O)O)s1. |
| Q: What is the molecular formula of 5-Methyl-5'-(2,2,2-trifluoroacetamido)-[2,3'-bithiophene]-4'-carboxylic acid? |
| A: Molecular formula of 5-Methyl-5'-(2,2,2-trifluoroacetamido)-[2,3'-bithiophene]-4'-carboxylic acid is C12H8F3NO3S2. |
| Q: What is the molecular weight of 5-Methyl-5'-(2,2,2-trifluoroacetamido)-[2,3'-bithiophene]-4'-carboxylic acid? |
| A: Molecular weight of 5-Methyl-5'-(2,2,2-trifluoroacetamido)-[2,3'-bithiophene]-4'-carboxylic acid is 335.3. |