Methyl spiro[cyclohexane-1,3'-indoline]-4-carboxylate structure
|
Common Name | Methyl spiro[cyclohexane-1,3'-indoline]-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 268538-23-4 | Molecular Weight | 245.317 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 381.4±42.0 °C at 760 mmHg | |
| Molecular Formula | C15H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.5±27.9 °C | |
| Name | methyl spiro[1,2-dihydroindole-3,4'-cyclohexane]-1'-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 381.4±42.0 °C at 760 mmHg |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.317 |
| Flash Point | 184.5±27.9 °C |
| Exact Mass | 245.141586 |
| PSA | 38.33000 |
| LogP | 2.66 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | FJBYWRPJPLSKLJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CCC2(CC1)CNc1ccccc12 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~%
Methyl spiro[cy... CAS#:268538-23-4 |
| Literature: Sakamoto, Toshihiro; Moriya, Minoru; Haga, Yuji; Takahashi, Toshiyuki; Shibata, Takunobu; Okamoto, Osamu; Nonoshita, Katsumasa; Kitazawa, Hidefumi; Hidaka, Masayasu; Gomori, Akira; Iwaasa, Hisashi; Ishihara, Akane; Kanatani, Akio; Fukami, Takehiro; Gao, Ying-Duo; MacNeil, Douglas J.; Yang, Lihu Bioorganic and Medicinal Chemistry Letters, 2009 , vol. 19, # 6 p. 1564 - 1568 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Methyl 1',2'-dihydrospiro[cyclohexane-1,3'-indole]-4-carboxylate |
| Spiro[cyclohexane-1,3'-[3H]indole]-4-carboxylic acid, 1',2'-dihydro-, methyl ester |
| Methyl spiro[cyclohexane-1,3'-indoline]-4-carboxylate |