2-[3-(2-sulfosulfanylethylamino)propanoylamino]-1,3-thiazole structure
|
Common Name | 2-[3-(2-sulfosulfanylethylamino)propanoylamino]-1,3-thiazole | ||
|---|---|---|---|---|
| CAS Number | 26865-75-8 | Molecular Weight | 311.40200 | |
| Density | 1.588g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H13N3O4S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[3-(2-sulfosulfanylethylamino)propanoylamino]-1,3-thiazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.588g/cm3 |
|---|---|
| Molecular Formula | C8H13N3O4S3 |
| Molecular Weight | 311.40200 |
| Exact Mass | 311.00700 |
| PSA | 173.80000 |
| LogP | 2.71850 |
| Index of Refraction | 1.651 |
| InChIKey | IQVBFYUOUDQRES-UHFFFAOYSA-N |
| SMILES | O=C(CCNCCSS(=O)(=O)O)Nc1nccs1 |
|
~%
2-[3-(2-sulfosu... CAS#:26865-75-8 |
| Literature: Westland,R.D. et al. Journal of Medicinal Chemistry, 1971 , vol. 14, # 10 p. 916 - 920 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| thiosulfuric acid S-[2-(2-thiazol-2-ylcarbamoyl-ethylamino)-ethyl] ester |
| Thiosulfuric acid (H2S2O3),S-(2-((3-oxo-3-(2-thiazolylamino)propyl)amino)ethyl) ester |
| 2-(2-Thiazolylcarbamoyl)ethyl>amino)ethyl hydrogenthiosulfat |
| S-2-<<2-(2-Thiazolylcarbamoyl)aethyl>-amino>-aethyl-thiosulfat |
| S-2-((2-Thiazolylcarbamoyl)ethyl)aminoethyl hydrogen thiosulfate |