N-(6-Chloro-2-phenyl-4-pyrimidinyl)-N-ethylamine structure
|
Common Name | N-(6-Chloro-2-phenyl-4-pyrimidinyl)-N-ethylamine | ||
|---|---|---|---|---|
| CAS Number | 26871-14-7 | Molecular Weight | 233.69700 | |
| Density | 1.235g/cm3 | Boiling Point | 299.2ºC at 760mmHg | |
| Molecular Formula | C12H12ClN3 | Melting Point | 69-71ºC | |
| MSDS | N/A | Flash Point | 134.7ºC | |
| Name | N-(6-Chloro-2-phenyl-4-pyrimidinyl)-N-ethylamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.235g/cm3 |
|---|---|
| Boiling Point | 299.2ºC at 760mmHg |
| Melting Point | 69-71ºC |
| Molecular Formula | C12H12ClN3 |
| Molecular Weight | 233.69700 |
| Flash Point | 134.7ºC |
| Exact Mass | 233.07200 |
| PSA | 37.81000 |
| LogP | 3.30180 |
| Vapour Pressure | 0.00121mmHg at 25°C |
| Index of Refraction | 1.617 |
| InChIKey | NMSYTXBYOPLTHK-UHFFFAOYSA-N |
| SMILES | CCNc1cc(Cl)nc(-c2ccccc2)n1 |
| HS Code | 2933599090 |
|---|
|
~%
N-(6-Chloro-2-p... CAS#:26871-14-7 |
| Literature: American Home Products Corporation Patent: US3940395 A1, 1976 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-chloro-N-ethyl-2-phenylpyrimidin-4-amine |