fmoc-d-4-aminomethylphenylalanine(boc) structure
|
Common Name | fmoc-d-4-aminomethylphenylalanine(boc) | ||
|---|---|---|---|---|
| CAS Number | 268731-06-2 | Molecular Weight | 516.585 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 734.3±60.0 °C at 760 mmHg | |
| Molecular Formula | C30H32N2O6 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 397.9±32.9 °C | |
| Name | Fmoc-4-(Boc-aminomethyl)-D-phenylalanine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 734.3±60.0 °C at 760 mmHg |
| Molecular Formula | C30H32N2O6 |
| Molecular Weight | 516.585 |
| Flash Point | 397.9±32.9 °C |
| Exact Mass | 516.226013 |
| PSA | 113.96000 |
| LogP | 6.08 |
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |
| Index of Refraction | 1.600 |
| InChIKey | QSPDPKLGXGMDAY-AREMUKBSSA-N |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(CC(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)cc1 |
| Storage condition | Store at 0-5°C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| L-Phenylalanine, 4-[[[(1,1-dimethylethoxy)carbonyl]amino]methyl]-N-[(9H-fluoren-9-ylmethoxy)carbonyl]- |
| fmoc-d-4-aminomethylphenylalanine(boc) |
| D-Phenylalanine, 4-[[[(1,1-dimethylethoxy)carbonyl]amino]methyl]-N-[(9H-fluoren-9-ylmethoxy)carbonyl]- |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-4-[({[(2-methyl-2-propanyl)oxy]carbonyl}amino)methyl]-L-phenylalanine |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-4-[({[(2-methyl-2-propanyl)oxy]carbonyl}amino)methyl]-D-phenylalanine |