2-Propen-1-one,1-(5-methyl-2-thienyl)-3-phenyl- structure
|
Common Name | 2-Propen-1-one,1-(5-methyl-2-thienyl)-3-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 26903-26-4 | Molecular Weight | 228.30900 | |
| Density | 1.167g/cm3 | Boiling Point | 379.8ºC at 760 mmHg | |
| Molecular Formula | C14H12OS | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 183.5ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (E)-1-(5-methylthiophen-2-yl)-3-phenylprop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.167g/cm3 |
|---|---|
| Boiling Point | 379.8ºC at 760 mmHg |
| Molecular Formula | C14H12OS |
| Molecular Weight | 228.30900 |
| Flash Point | 183.5ºC |
| Exact Mass | 228.06100 |
| PSA | 45.31000 |
| LogP | 3.95260 |
| Vapour Pressure | 5.72E-06mmHg at 25°C |
| Index of Refraction | 1.638 |
| InChIKey | AOUMOFQEBZGSPD-CMDGGOBGSA-N |
| SMILES | Cc1ccc(C(=O)C=Cc2ccccc2)s1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319-H413 |
| Precautionary Statements | P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
|
Percutaneous penetration modifiers and formulation effects.
Int. J. Pharm. 386 , 42-51, (2010) The enhancement/retardation of percutaneous permeation of diethyl-m-toluamide (DEET) in the presence of five percutaneous penetration modifiers (laurocapram, 3-dodecanoyloxazolidin-2-one (N-0915), S,S... |
| 2-trans-cinnamoyl-5-methyl-thiophene |
| 1-(5-Methyl-2-thienyl)-3-phenyl-2-Propen-1-one 1-(5-Methyl-thiophen-2-yl)-3-phenyl-propenone |