Toluene ethylsulfonamide structure
|
Common Name | Toluene ethylsulfonamide | ||
|---|---|---|---|---|
| CAS Number | 26914-52-3 | Molecular Weight | 398.54000 | |
| Density | 1.21 | Boiling Point | N/A | |
| Molecular Formula | C18H26N2O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193 °C | |
| Name | Toluene ethylsulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21 |
|---|---|
| Molecular Formula | C18H26N2O4S2 |
| Molecular Weight | 398.54000 |
| Flash Point | 193 °C |
| Exact Mass | 398.13300 |
| PSA | 109.10000 |
| LogP | 5.52980 |
| InChIKey | IDLSDSKPHLCUTN-UHFFFAOYSA-N |
| SMILES | CCNS(=O)(=O)c1ccc(C)cc1.CCNS(=O)(=O)c1ccccc1C |
| Water Solubility | <0.01 g/100 mL at 18 ºC |
| Hazard Codes | Xn |
|---|---|
| Risk Phrases | R68:Possible risk of irreversible effects. R36/37:Irritating to eyes and respiratory system . R22:Harmful if swallowed. |
| Safety Phrases | S36/37-S26 |
| HS Code | 2935009090 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| N-ethyl-o(or p)-toluenesulphonamide |
| MFCD00152499 |
| N-ETHYLTOLUENESULFONAMIDE |
| Ethyltoulenesulfonamide |
| Plasticizer 8 |
| N-ethyl-o(or p)-toluenesulfonamide |
| santicizer 8 |
| N-Ethyltoluene-4-Sulfonamide |
| N-ETHYL-2(OR4)-TOLUENESULFONAMIDE |
| EINECS 232-465-2 |