Fmoc-(R)-3-Amino-4-(1-naphthyl)-butyric acid
Fmoc-(R)-3-Amino-4-(1-naphthyl)-butyric acid structure
|
Common Name | Fmoc-(R)-3-Amino-4-(1-naphthyl)-butyric acid | ||
|---|---|---|---|---|
| CAS Number | 269398-89-2 | Molecular Weight | 451.51300 | |
| Density | 1.275g/cm3 | Boiling Point | 702.5ºC at 760mmHg | |
| Molecular Formula | C29H25NO4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 378.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Fmoc-(R)-3-amino-4-(1-naphthyl)-butyric acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.275g/cm3 |
|---|---|
| Boiling Point | 702.5ºC at 760mmHg |
| Molecular Formula | C29H25NO4 |
| Molecular Weight | 451.51300 |
| Flash Point | 378.7ºC |
| Exact Mass | 451.17800 |
| PSA | 75.63000 |
| LogP | 6.15520 |
| Vapour Pressure | 4.3E-20mmHg at 25°C |
| Index of Refraction | 1.671 |
| InChIKey | QKDVUQGMQTZWKV-OAQYLSRUSA-N |
| SMILES | O=C(O)CC(Cc1cccc2ccccc12)NC(=O)OCC1c2ccccc2-c2ccccc21 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Fmoc-D-b-HoAla(1-naphthyl)-OH |
| RARECHEM AK PT F050 |
| MFCD01860936 |
| (R)-3-(Fmoc-amino)-4-(1-naphthyl)butyric acid |
| FMOC-D-ALA(1-NAPH)-(C*CH2)OH |
| (R)-3-(9H-fluoren-9-ylmethoxy-carbonylamino)-4-naphthalen-1-yl-butyric acid |
| FMOC-(R)-3-AMINO-4-(1-NAPHTHYL)BUTANOIC ACID |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Fmoc-(R)-3-amino-4-(1-naphthyl)-butyric acid? |
| A: SMILES notation of Fmoc-(R)-3-amino-4-(1-naphthyl)-butyric acid is O=C(O)CC(Cc1cccc2ccccc12)NC(=O)OCC1c2ccccc2-c2ccccc21. |
| Q: What is the polar surface area (PSA) of Fmoc-(R)-3-amino-4-(1-naphthyl)-butyric acid? |
| A: Polar surface area (PSA) of Fmoc-(R)-3-amino-4-(1-naphthyl)-butyric acid is 75.63000. |
| Q: What is the CAS number of Fmoc-(R)-3-amino-4-(1-naphthyl)-butyric acid? |
| A: CAS number of Fmoc-(R)-3-amino-4-(1-naphthyl)-butyric acid is 269398-89-2. |
| Q: What is the molecular formula of Fmoc-(R)-3-amino-4-(1-naphthyl)-butyric acid? |
| A: Molecular formula of Fmoc-(R)-3-amino-4-(1-naphthyl)-butyric acid is C29H25NO4. |
| Q: What is the molecular weight of Fmoc-(R)-3-amino-4-(1-naphthyl)-butyric acid? |
| A: Molecular weight of Fmoc-(R)-3-amino-4-(1-naphthyl)-butyric acid is 451.51300. |
| Q: What is the boiling point of Fmoc-(R)-3-amino-4-(1-naphthyl)-butyric acid? |
| A: Boiling point of Fmoc-(R)-3-amino-4-(1-naphthyl)-butyric acid is 702.5ºC at 760mmHg. |
| Q: What is the safety information for Fmoc-(R)-3-amino-4-(1-naphthyl)-butyric acid? |
| A: Safety information for Fmoc-(R)-3-amino-4-(1-naphthyl)-butyric acid: 45. |
| Q: What English synonyms does Fmoc-(R)-3-amino-4-(1-naphthyl)-butyric acid have? |
| A: English synonyms of Fmoc-(R)-3-amino-4-(1-naphthyl)-butyric acid: Fmoc-D-b-HoAla(1-naphthyl)-OH, RARECHEM AK PT F050, MFCD01860936, (R)-3-(Fmoc-amino)-4-(1-naphthyl)butyric acid, FMOC-D-ALA(1-NAPH)-(C*CH2)OH, (R)-3-(9H-fluoren-9-ylmethoxy-carbonylamino)-4-naphthalen-1-yl-butyric acid, FMOC-(R)-3-AMINO-4-(1-NAPHTHYL)BUTANOIC ACID. |
| Q: What is the LogP of Fmoc-(R)-3-amino-4-(1-naphthyl)-butyric acid? |
| A: LogP of Fmoc-(R)-3-amino-4-(1-naphthyl)-butyric acid is 6.15520. |
| Q: What is the InChIKey of Fmoc-(R)-3-amino-4-(1-naphthyl)-butyric acid? |
| A: InChIKey of Fmoc-(R)-3-amino-4-(1-naphthyl)-butyric acid is QKDVUQGMQTZWKV-OAQYLSRUSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |