2-[2-[2-(3,4-dimethoxyphenyl)acetyl]-4,5-dimethoxyphenyl]acetic acid structure
|
Common Name | 2-[2-[2-(3,4-dimethoxyphenyl)acetyl]-4,5-dimethoxyphenyl]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 26954-85-8 | Molecular Weight | 374.38400 | |
| Density | 1.227g/cm3 | Boiling Point | 568.8ºC at 760mmHg | |
| Molecular Formula | C20H22O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.9ºC | |
| Name | 2-[2-[2-(3,4-dimethoxyphenyl)acetyl]-4,5-dimethoxyphenyl]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.227g/cm3 |
|---|---|
| Boiling Point | 568.8ºC at 760mmHg |
| Molecular Formula | C20H22O7 |
| Molecular Weight | 374.38400 |
| Flash Point | 199.9ºC |
| Exact Mass | 374.13700 |
| PSA | 91.29000 |
| LogP | 2.77350 |
| Vapour Pressure | 8.93E-14mmHg at 25°C |
| Index of Refraction | 1.559 |
| InChIKey | MGTCSBXFQWXQDZ-UHFFFAOYSA-N |
| SMILES | COc1ccc(CC(=O)c2cc(OC)c(OC)cc2CC(=O)O)cc1OC |
|
~85%
2-[2-[2-(3,4-di... CAS#:26954-85-8 |
| Literature: Yamato, Takehiko; Inoue, Hisataka; Fukumoto, Maki; Tashiro, Masashi Organic Preparations and Procedures International, 1995 , vol. 27, # 4 p. 495 - 498 |
|
~0%
2-[2-[2-(3,4-di... CAS#:26954-85-8 |
| Literature: Venkov, Atanas P.; Ivanov, Ilian I. Tetrahedron, 1996 , vol. 52, # 37 p. 12299 - 12308 |
|
~%
2-[2-[2-(3,4-di... CAS#:26954-85-8 |
| Literature: Nizamuddin, S.; Ghosal, M. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1981 , vol. 20, # 5 p. 431 - 432 |
| 6-(3,4-dimethoxyphenylacetyl)-3,4-dimethoxyphenylacetic acid |
| benzeneacetic acid,2-[2-(3,4-dimethoxyphenyl)acetyl]-4,5-dimethoxy |
| Acide (dimethoxy-3',4'-phenacetyl)-2-dimethoxy-4,5-phenyl acetique [French] |
| 2-((3,4-Dimethoxyphenyl)acetyl)-4,5-dimethoxybenzeneacetic acid |
| (2-homoveratroyl-4,5-dimethoxyphenyl)acetic acid |
| 6-(3,4-dimethoxyphenylmethylcarbonyl)-3,4-dimethoxyphenylacetic acid |
| (2-homoveratryl-4,5-dimethoxyphenyl)acetic acid |
| Benzeneacetic acid,2-((3,4-dimethoxyphenyl)acetyl)-4,5-dimethoxy |
| 2-(2-(2-(3,4-DIMETHOXYPHENYL)ACETYL)-4,5-DIMETHOXYPHENYL)ACETIC ACID |
| 2-<(3,4-dimethoxyphenyl)acetyl>-4,5-dimethoxyphenylacetic acid |