3-(4-bromo-3,5-dimethyl-1H-pyrrol-2-ylmethylene)-1,3-dihydro-indol-2-one structure
|
Common Name | 3-(4-bromo-3,5-dimethyl-1H-pyrrol-2-ylmethylene)-1,3-dihydro-indol-2-one | ||
|---|---|---|---|---|
| CAS Number | 856434-66-7 | Molecular Weight | 317.18 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H13BrN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(4-bromo-3,5-dimethyl-1H-pyrrol-2-ylmethylene)-1,3-dihydro-indol-2-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H13BrN2O |
|---|---|
| Molecular Weight | 317.18 |
| InChIKey | RNZBDLCTBWAQPA-UHFFFAOYSA-N |
| SMILES | Cc1[nH]c(C=C2C(=O)Nc3ccccc32)c(C)c1Br |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3-(4-bromo-3,5-dimethyl-1H-pyrrol-2-ylmethylene)-1,3-dihydro-indol-2-one? |
| A: Molecular formula of 3-(4-bromo-3,5-dimethyl-1H-pyrrol-2-ylmethylene)-1,3-dihydro-indol-2-one is C15H13BrN2O. |
| Q: What is the molecular weight of 3-(4-bromo-3,5-dimethyl-1H-pyrrol-2-ylmethylene)-1,3-dihydro-indol-2-one? |
| A: Molecular weight of 3-(4-bromo-3,5-dimethyl-1H-pyrrol-2-ylmethylene)-1,3-dihydro-indol-2-one is 317.18. |
| Q: What is the InChIKey of 3-(4-bromo-3,5-dimethyl-1H-pyrrol-2-ylmethylene)-1,3-dihydro-indol-2-one? |
| A: InChIKey of 3-(4-bromo-3,5-dimethyl-1H-pyrrol-2-ylmethylene)-1,3-dihydro-indol-2-one is RNZBDLCTBWAQPA-UHFFFAOYSA-N. |
| Q: What is the English name of 3-(4-bromo-3,5-dimethyl-1H-pyrrol-2-ylmethylene)-1,3-dihydro-indol-2-one? |
| A: The English name of 3-(4-bromo-3,5-dimethyl-1H-pyrrol-2-ylmethylene)-1,3-dihydro-indol-2-one is 3-(4-bromo-3,5-dimethyl-1H-pyrrol-2-ylmethylene)-1,3-dihydro-indol-2-one. |
| Q: What is the CAS number of 3-(4-bromo-3,5-dimethyl-1H-pyrrol-2-ylmethylene)-1,3-dihydro-indol-2-one? |
| A: CAS number of 3-(4-bromo-3,5-dimethyl-1H-pyrrol-2-ylmethylene)-1,3-dihydro-indol-2-one is 856434-66-7. |
| Q: What is the SMILES notation of 3-(4-bromo-3,5-dimethyl-1H-pyrrol-2-ylmethylene)-1,3-dihydro-indol-2-one? |
| A: SMILES notation of 3-(4-bromo-3,5-dimethyl-1H-pyrrol-2-ylmethylene)-1,3-dihydro-indol-2-one is Cc1[nH]c(C=C2C(=O)Nc3ccccc32)c(C)c1Br. |
| Q: What is the Chinese name of 856434-66-7? |
| A: Chinese name of 856434-66-7 is 856434-66-7. |