Benzenesulfonic acid,4-chloro-, 4-nitrophenyl ester structure
|
Common Name | Benzenesulfonic acid,4-chloro-, 4-nitrophenyl ester | ||
|---|---|---|---|---|
| CAS Number | 26971-85-7 | Molecular Weight | 313.71400 | |
| Density | 1.516g/cm3 | Boiling Point | 484.8ºC at 760mmHg | |
| Molecular Formula | C12H8ClNO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247ºC | |
| Name | (4-nitrophenyl) 4-chlorobenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.516g/cm3 |
|---|---|
| Boiling Point | 484.8ºC at 760mmHg |
| Molecular Formula | C12H8ClNO5S |
| Molecular Weight | 313.71400 |
| Flash Point | 247ºC |
| Exact Mass | 312.98100 |
| PSA | 97.57000 |
| LogP | 4.61990 |
| Vapour Pressure | 4.4E-09mmHg at 25°C |
| Index of Refraction | 1.622 |
| InChIKey | GPDGTKIBAZPSFN-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(OS(=O)(=O)c2ccc(Cl)cc2)cc1 |
| HS Code | 2906299090 |
|---|
|
~%
Benzenesulfonic... CAS#:26971-85-7 |
| Literature: Um, Ik-Hwan; Akhtar, Kalsoom Bulletin of the Korean Chemical Society, 2010 , vol. 31, # 1 p. 234 - 237 |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| p-Nitrophenyl p-chlorobenzenesulphonate |
| 4-nitrophenyl 4-chlorobenzenesulfonate |
| 4-Chlor-benzolsulfonsaeure-(4-nitro-phenylester) |