(+)-lariciresinol structure
|
Common Name | (+)-lariciresinol | ||
|---|---|---|---|---|
| CAS Number | 27003-73-2 | Molecular Weight | 360.401 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 568.4±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H24O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 297.6±30.1 °C | |
Use of (+)-lariciresinolLariciresinol is a compound isolated from Arabidopsis thaliana[1]. |
| Name | (+)-lariciresinol |
|---|---|
| Synonym | More Synonyms |
| Description | Lariciresinol is a compound isolated from Arabidopsis thaliana[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 568.4±50.0 °C at 760 mmHg |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.401 |
| Flash Point | 297.6±30.1 °C |
| Exact Mass | 360.157288 |
| PSA | 88.38000 |
| LogP | 1.64 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | MHXCIKYXNYCMHY-AUSJPIAWSA-N |
| SMILES | COc1cc(CC2COC(c3ccc(O)c(OC)c3)C2CO)ccc1O |
| 4-[(2S,3R,4R)-4-(4-Hydroxy-3-methoxybenzyl)-3-(hydroxymethyl)tetrahydro-2-furanyl]-2-methoxyphenol |
| UNII-73XCE5OZB0 |
| 3-Furanmethanol, tetrahydro-2-(4-hydroxy-3-methoxyphenyl)-4-[(4-hydroxy-3-methoxyphenyl)methyl]-, (2S,3R,4R)- |
| lariciresinol |
| 4-[[(3R,4R,5S)-5-(4-hydroxy-3-methoxyphenyl)-4-(hydroxymethyl)oxolan-3-yl]methyl]-2-methoxyphenol |
| Lariciresinol, (+)- |
| Arbo 4 |