Ethanone,1-(1-methyl-2,2-diphenylcyclopropyl)- structure
|
Common Name | Ethanone,1-(1-methyl-2,2-diphenylcyclopropyl)- | ||
|---|---|---|---|---|
| CAS Number | 27067-38-5 | Molecular Weight | 250.33500 | |
| Density | 1.089g/cm3 | Boiling Point | 360ºC at 760mmHg | |
| Molecular Formula | C18H18O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.8ºC | |
| Name | 1-(1-methyl-2,2-diphenylcyclopropyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.089g/cm3 |
|---|---|
| Boiling Point | 360ºC at 760mmHg |
| Molecular Formula | C18H18O |
| Molecular Weight | 250.33500 |
| Flash Point | 153.8ºC |
| Exact Mass | 250.13600 |
| PSA | 17.07000 |
| LogP | 3.97170 |
| Vapour Pressure | 2.29E-05mmHg at 25°C |
| Index of Refraction | 1.579 |
| InChIKey | VTFOQHQLFOFXQL-UHFFFAOYSA-N |
| SMILES | CC(=O)C1(C)CC1(c1ccccc1)c1ccccc1 |
|
~%
Ethanone,1-(1-m... CAS#:27067-38-5 |
| Literature: Impastato,F.J.; Walborsky,H.M. Journal of the American Chemical Society, 1962 , vol. 84, p. 4838 - 4843 |
|
~%
Ethanone,1-(1-m... CAS#:27067-38-5 |
| Literature: Biellmann,J.F. et al. Tetrahedron, 1976 , vol. 32, p. 1801 - 1805 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| rac-1-Methyl-1-acetyl-2,2-diphenyl-cyclopropan |