Di-tert-butyl(1-methyl-2,2-diphenylcyclopropyl)phosphine structure
|
Common Name | Di-tert-butyl(1-methyl-2,2-diphenylcyclopropyl)phosphine | ||
|---|---|---|---|---|
| CAS Number | 742103-27-1 | Molecular Weight | 352.49300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H33P | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | ditert-butyl-(1-methyl-2,2-diphenylcyclopropyl)phosphane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H33P |
|---|---|
| Molecular Weight | 352.49300 |
| Exact Mass | 352.23200 |
| PSA | 13.59000 |
| LogP | 7.21400 |
| InChIKey | QMLPJDVGNRHGJQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)P(C(C)(C)C)C1(C)CC1(c1ccccc1)c1ccccc1 |
| Storage condition | 2~8℃ |
| Hazard Codes | Xi |
|---|---|
| RIDADR | NONH for all modes of transport |
|
~65%
Di-tert-butyl(1... CAS#:742103-27-1 |
| Literature: Suzuki, Ken; Hori, Yoji; Kobayashi, Tohru Advanced Synthesis and Catalysis, 2008 , vol. 350, # 5 p. 652 - 656 |
|
~46%
Di-tert-butyl(1... CAS#:742103-27-1 |
| Literature: TAKASAGO INTERNATIONAL CORPORATION Patent: WO2004/72088 A2, 2004 ; Location in patent: Page/Page column 45-46 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Mo-Phos |
| di-tert-butyl(1-methyl-2,2-diphenylcyclopropyl)phosphine |
| Di-t-butyl(2,2-diphenyl-1-methylcyclopropyl)phosphinecBRIDP |
| di-t-butyl(2,2-diphenyl-1-methyl-1-cyclopropyl)phosphine |
| cBRIDP |
| Phosphine,bis(1,1-dimethylethyl)(1-methyl-2,2-diphenylcyclopropyl) |
| (2,2-DIPHENYL-1-(DI-TERT-BUTYLPHOSPHINO)-1-METHYLCYCLOPROPANE) |
| di-tert-butyl(2,2-diphenyl-1-methyl-1-cyclopropyl)phosphine |
| di-t-butyl-(2,2-diphenyl-1-methylcyclopropyl)phosphine |