Methanone,1H-benzimidazol-2-yl(4-chlorophenyl)- structure
|
Common Name | Methanone,1H-benzimidazol-2-yl(4-chlorophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 27099-25-8 | Molecular Weight | 256.68700 | |
| Density | 1.386g/cm3 | Boiling Point | 480ºC at 760 mmHg | |
| Molecular Formula | C14H9ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.1ºC | |
| Name | 1H-benzimidazol-2-yl-(4-chlorophenyl)methanone |
|---|
| Density | 1.386g/cm3 |
|---|---|
| Boiling Point | 480ºC at 760 mmHg |
| Molecular Formula | C14H9ClN2O |
| Molecular Weight | 256.68700 |
| Flash Point | 244.1ºC |
| Exact Mass | 256.04000 |
| PSA | 45.75000 |
| LogP | 3.44730 |
| Vapour Pressure | 2.25E-09mmHg at 25°C |
| Index of Refraction | 1.696 |
| InChIKey | LTWRVZHVZXZEEP-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(Cl)cc1)c1nc2ccccc2[nH]1 |
|
~62%
Methanone,1H-be... CAS#:27099-25-8 |
| Literature: Demirayak, Seref; Kayagil, Ismail; Yurttas, Leyla European Journal of Medicinal Chemistry, 2011 , vol. 46, # 1 p. 411 - 416 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |