1,3,5,2,4,6-Triazatriphosphorine,2,2,4,4,6,6-hexahydro-2,2,4,4,6,6-hexakis(2-nitrophenoxy)- (9CI) structure
|
Common Name | 1,3,5,2,4,6-Triazatriphosphorine,2,2,4,4,6,6-hexahydro-2,2,4,4,6,6-hexakis(2-nitrophenoxy)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 27122-72-1 | Molecular Weight | 963.54700 | |
| Density | 1.73g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C36H24N9O18P3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,4,4,6,6-hexakis(2-nitrophenoxy)-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.73g/cm3 |
|---|---|
| Molecular Formula | C36H24N9O18P3 |
| Molecular Weight | 963.54700 |
| Exact Mass | 963.04500 |
| PSA | 396.81000 |
| LogP | 13.20780 |
| Index of Refraction | 1.732 |
| InChIKey | DIPGBICDJVNPOP-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1OP1(Oc2ccccc2[N+](=O)[O-])=NP(Oc2ccccc2[N+](=O)[O-])(Oc2ccccc2[N+](=O)[O-])=NP(Oc2ccccc2[N+](=O)[O-])(Oc2ccccc2[N+](=O)[O-])=N1 |
|
~%
1,3,5,2,4,6-Tri... CAS#:27122-72-1 |
| Literature: Allcock,H.R.; Smeltz,L.A. Journal of the American Chemical Society, 1976 , vol. 98, p. 4143 - 4149 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| Hexakis-(2-nitro-phenoxy)-cyclotriphosphonitril |
| 2,2,4,4,6,6-hexakis(2-nitrophenoxy)-1,3,5-triaza-2 |
| Hexakis-<2-nitro-phenoxy>-cyclotriphosphazen |