Metolazone-d7 structure
|
Common Name | Metolazone-d7 | ||
|---|---|---|---|---|
| CAS Number | 2714484-71-4 | Molecular Weight | 372.88 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H9D7ClN3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Metolazone-d7Metolazone-d7 is deuterium labeled Metolazone. Metolazone (SR-720-22) is primarily used to treat congestive heart failure and high blood pressure. |
| Name | Metolazone-d7 |
|---|
| Description | Metolazone-d7 is deuterium labeled Metolazone. Metolazone (SR-720-22) is primarily used to treat congestive heart failure and high blood pressure. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
[2]. Stern A. Metolazone, a diuretic agent. Am Heart J. 1976 Feb;91(2):262-3. |
| Molecular Formula | C16H9D7ClN3O3S |
|---|---|
| Molecular Weight | 372.88 |
| InChIKey | AQCHWTWZEMGIFD-HRDWIZOWSA-N |
| SMILES | Cc1ccccc1N1C(=O)c2cc(S(N)(=O)=O)c(Cl)cc2NC1C |