1,2,3-Benzotriazin-4(3H)-one,3-(2-nitrophenyl)- structure
|
Common Name | 1,2,3-Benzotriazin-4(3H)-one,3-(2-nitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 27222-99-7 | Molecular Weight | 268.22800 | |
| Density | 1.49g/cm3 | Boiling Point | 451.4ºC at 760mmHg | |
| Molecular Formula | C13H8N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.8ºC | |
| Name | 3-(2-nitrophenyl)-1,2,3-benzotriazin-4-one |
|---|
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 451.4ºC at 760mmHg |
| Molecular Formula | C13H8N4O3 |
| Molecular Weight | 268.22800 |
| Flash Point | 226.8ºC |
| Exact Mass | 268.06000 |
| PSA | 93.60000 |
| LogP | 2.21210 |
| Vapour Pressure | 2.45E-08mmHg at 25°C |
| Index of Refraction | 1.727 |
| InChIKey | NMJLHPXOQVOOKE-UHFFFAOYSA-N |
| SMILES | O=c1c2ccccc2nnn1-c1ccccc1[N+](=O)[O-] |
|
~%
1,2,3-Benzotria... CAS#:27222-99-7 |
| Literature: Ludwig, Miroslav; Bauerova, Ingrid Collection of Czechoslovak Chemical Communications, 1998 , vol. 63, # 12 p. 2075 - 2084 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |