Butanal, 2-methylene-,2-(2,4-dinitrophenyl)hydrazone structure
|
Common Name | Butanal, 2-methylene-,2-(2,4-dinitrophenyl)hydrazone | ||
|---|---|---|---|---|
| CAS Number | 27227-40-3 | Molecular Weight | 264.23700 | |
| Density | 1.324g/cm3 | Boiling Point | 412.32ºC at 760 mmHg | |
| Molecular Formula | C11H12N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.164ºC | |
| Name | N-[(E)-2-methylidenebutylideneamino]-2,4-dinitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.324g/cm3 |
|---|---|
| Boiling Point | 412.32ºC at 760 mmHg |
| Molecular Formula | C11H12N4O4 |
| Molecular Weight | 264.23700 |
| Flash Point | 203.164ºC |
| Exact Mass | 264.08600 |
| PSA | 116.03000 |
| LogP | 3.98630 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | IKGOFVCRDIYGCO-GHXNOFRVSA-N |
| SMILES | C=C(C=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])CC |
|
~93%
Butanal, 2-meth... CAS#:27227-40-3 |
| Literature: Saprygina; Zlot-skii; Rakhmankulov Journal of applied chemistry of the USSR, 1987 , vol. 60, # 4 pt 2 p. 862 - 866 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Aethylprop-2-enal-2,4-dinitrophenylhydrazon |
| 2-ethyl-acrylaldehyde-(2,4-dinitro-phenylhydrazone) |
| 2-Ethylacrolein-(2,4-dinitrophenylhydrazon) |
| 2-Ethylacrylaldehyd-(2,4-dinitro-phenylhydrazon) |
| 2-ethylacrolein (2,4-dinitrophenyl)hydrazone |
| 1-(2,4-dinitrophenyl)-2-(2-methylidenebutylidene)hydrazine |
| 2-Aethyl-acrylaldehyd-(2,4-dinitro-phenylhydrazon) |