tert-butyl 2-ethoxycarbothioylsulfanylacetate
tert-butyl 2-ethoxycarbothioylsulfanylacetate structure
|
Common Name | tert-butyl 2-ethoxycarbothioylsulfanylacetate | ||
|---|---|---|---|---|
| CAS Number | 27240-57-9 | Molecular Weight | 236.35200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H16O3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-butyl 2-ethoxycarbothioylsulfanylacetate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H16O3S2 |
|---|---|
| Molecular Weight | 236.35200 |
| Exact Mass | 236.05400 |
| PSA | 92.92000 |
| LogP | 2.38270 |
| InChIKey | PUWFWBUIBGCOIP-UHFFFAOYSA-N |
| SMILES | CCOC(=S)SCC(=O)OC(C)(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~96%
tert-butyl 2-et... CAS#:27240-57-9 |
| Literature: Moore, Susanna; Jaeschke, Holger; Kleinau, Gunnar; Neumann, Susanne; Costanzi, Stefano; Jiang, Jian-Kang; Childress, John; Raaka, Bruce M.; Colson, Anny; Paschke, Ralf; Krause, Gerd; Thomas, Craig J.; Gershengorn, Marvin C. Journal of Medicinal Chemistry, 2006 , vol. 49, # 13 p. 3888 - 3896 |
|
~94%
tert-butyl 2-et... CAS#:27240-57-9 |
| Literature: GLAXO GROUP LIMITED Patent: WO2008/34860 A1, 2008 ; Location in patent: Page/Page column 93 ; WO 2008/034860 A1 |
|
~%
tert-butyl 2-et... CAS#:27240-57-9 |
| Literature: Kricheldorf,H.R.; Kaschig,J. Justus Liebigs Annalen der Chemie, 1976 , p. 882 - 890 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 6 | |
|---|---|
| DownStream 2 | |
CAS#:188560-12-5![2-Methyl-2-propanyl (4-bromo-1H-pyrrolo[2,3-b]pyridin-2-yl)acetat e structure](https://image.chemsrc.com/caspic/220/1014612-91-9.png)
CAS#:1014612-91-9This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| tert-butyl ethoxythiocarbonylsulfanylacetate |
| Xanthogenessigsaeure-tert.-butylester |
| Acetic acid,[(ethoxythioxomethyl)thio]-,1,1-dimethylethyl ester |
| O-ethyl S-(tert-butoxycarbonyl)methyl dithiocarbonate |
| 1,1-dimethylethyl {[(ethyloxy)carbonothioyl]thio}acetate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of tert-butyl 2-ethoxycarbothioylsulfanylacetate? |
| A: SMILES notation of tert-butyl 2-ethoxycarbothioylsulfanylacetate is CCOC(=S)SCC(=O)OC(C)(C)C. |
| Q: What is the InChIKey of tert-butyl 2-ethoxycarbothioylsulfanylacetate? |
| A: InChIKey of tert-butyl 2-ethoxycarbothioylsulfanylacetate is PUWFWBUIBGCOIP-UHFFFAOYSA-N. |
| Q: What is the English name of tert-butyl 2-ethoxycarbothioylsulfanylacetate? |
| A: The English name of tert-butyl 2-ethoxycarbothioylsulfanylacetate is tert-butyl 2-ethoxycarbothioylsulfanylacetate. |
| Q: What is the molecular formula of tert-butyl 2-ethoxycarbothioylsulfanylacetate? |
| A: Molecular formula of tert-butyl 2-ethoxycarbothioylsulfanylacetate is C9H16O3S2. |
| Q: What is the CAS number of tert-butyl 2-ethoxycarbothioylsulfanylacetate? |
| A: CAS number of tert-butyl 2-ethoxycarbothioylsulfanylacetate is 27240-57-9. |
| Q: What is the LogP of tert-butyl 2-ethoxycarbothioylsulfanylacetate? |
| A: LogP of tert-butyl 2-ethoxycarbothioylsulfanylacetate is 2.38270. |
| Q: What are the upstream materials of tert-butyl 2-ethoxycarbothioylsulfanylacetate? |
| A: Related upstream materials(CAS) of tert-butyl 2-ethoxycarbothioylsulfanylacetate: 107-59-5;140-89-6;151-01-9;5292-43-3;75-15-0;141-52-6. |
| Q: What is the polar surface area (PSA) of tert-butyl 2-ethoxycarbothioylsulfanylacetate? |
| A: Polar surface area (PSA) of tert-butyl 2-ethoxycarbothioylsulfanylacetate is 92.92000. |
| Q: What is the Chinese name of 27240-57-9? |
| A: Chinese name of 27240-57-9 is 27240-57-9. |
| Q: What is the molecular weight of tert-butyl 2-ethoxycarbothioylsulfanylacetate? |
| A: Molecular weight of tert-butyl 2-ethoxycarbothioylsulfanylacetate is 236.35200. |