Ultraviolet Absorbent UV-1164 structure
|
Common Name | Ultraviolet Absorbent UV-1164 | ||
|---|---|---|---|---|
| CAS Number | 2725-22-6 | Molecular Weight | 509.682 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 695.2±65.0 °C at 760 mmHg | |
| Molecular Formula | C33H39N3O2 | Melting Point | 88-91ºC | |
| MSDS | N/A | Flash Point | 374.3±34.3 °C | |
| Name | 2-[4,6-Bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-5-(octyloxy)phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 695.2±65.0 °C at 760 mmHg |
| Melting Point | 88-91ºC |
| Molecular Formula | C33H39N3O2 |
| Molecular Weight | 509.682 |
| Flash Point | 374.3±34.3 °C |
| Exact Mass | 509.304230 |
| PSA | 68.13000 |
| LogP | 11.65 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | ZSSVCEUEVMALRD-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOc1ccc(-c2nc(-c3ccc(C)cc3C)nc(-c3ccc(C)cc3C)n2)c(O)c1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 2-(2-hydroxy-4-n-octyloxyphenyl)-4,6-bis(2,4-dimethylphenyl)-1,3,5-triazine |
| Phenol, 2-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-5-(octyloxy)- |
| 2,4-Bis(2,4-dimethylphenyl)-6-(2-hydroxy-4-octyloxyphenyl)-1,3,5-triazine |
| 2-[4,6-Bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-5-(octyloxy)phenol |
| MFCD09038603 |
| T6N CN ENJ BR BQ DO8& DR B1 D1& FR B1 D1 |
| 2-(4,6-BIS-(2,4-DIMETHYLPHENYL)-1,3,5-TRIAZIN-2-YL)-5-(OCTYLOXY)-PHENOL |