5-methoxy-3-phenyl-1H-indole-2-carboxylic acid ethyl ester structure
|
Common Name | 5-methoxy-3-phenyl-1H-indole-2-carboxylic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 27294-08-2 | Molecular Weight | 295.33200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 5-methoxy-3-phenyl-1H-indole-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H17NO3 |
|---|---|
| Molecular Weight | 295.33200 |
| Exact Mass | 295.12100 |
| PSA | 51.32000 |
| LogP | 4.02020 |
| InChIKey | DOIDLAVLCKENCM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1[nH]c2ccc(OC)cc2c1-c1ccccc1 |
|
~%
5-methoxy-3-phe... CAS#:27294-08-2 |
| Literature: Hughes; Lions Journal and Proceedings of the Royal Society of New South Wales, 1937 , vol. 71, p. 475,482 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5-methoxy-3-phenyl-indole-2-carboxylic acid ethyl ester |
| 5-Methoxy-3-phenyl-indol-2-carbonsaeure-aethylester |
| ethyl 5-methoxy-3-phenylindole-2-carboxylate |