2-Benzylacetoacetic Acid Ethyl Ester structure
|
Common Name | 2-Benzylacetoacetic Acid Ethyl Ester | ||
|---|---|---|---|---|
| CAS Number | 620-79-1 | Molecular Weight | 220.26400 | |
| Density | 1.036 g/mL at 25 °C(lit.) | Boiling Point | 276 °C(lit.) | |
| Molecular Formula | C13H16O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Name | ethyl 2-benzylacetoacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.036 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 276 °C(lit.) |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.26400 |
| Flash Point | >230 °F |
| Exact Mass | 220.11000 |
| PSA | 43.37000 |
| LogP | 1.99740 |
| Index of Refraction | n20/D 1.5(lit.) |
| InChIKey | XDWQYMXQMNUWID-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Cc1ccccc1)C(C)=O |
| Storage condition | -20°C Freezer |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| ethyl 2-benzyl-3-oxobutanoate |
| MFCD00009156 |
| EINECS 210-651-4 |