(S)-TERT-BUTYL2,2-DIMETHYL-4-(2-OXOETHYL)OXAZOLIDINE-3-CARBOXYLATE structure
|
Common Name | (S)-TERT-BUTYL2,2-DIMETHYL-4-(2-OXOETHYL)OXAZOLIDINE-3-CARBOXYLATE | ||
|---|---|---|---|---|
| CAS Number | 27304-75-2 | Molecular Weight | 304.40700 | |
| Density | 1.188g/cm3 | Boiling Point | 450.2ºC at 760mmHg | |
| Molecular Formula | C16H20N2O2S | Melting Point | 98-100ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 226.1ºC | |
| Name | (1S)-1-phenyl-N-[[(1S)-1-phenylethyl]sulfamoyl]ethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.188g/cm3 |
|---|---|
| Boiling Point | 450.2ºC at 760mmHg |
| Melting Point | 98-100ºC(lit.) |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.40700 |
| Flash Point | 226.1ºC |
| Exact Mass | 304.12500 |
| PSA | 66.58000 |
| LogP | 4.79540 |
| Vapour Pressure | 2.68E-08mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | ZUMVQOILJDLACR-KBPBESRZSA-N |
| SMILES | CC(NS(=O)(=O)NC(C)c1ccccc1)c1ccccc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
|
~91%
(S)-TERT-BUTYL2... CAS#:27304-75-2 |
| Literature: Hawkins, Joel M.; Sharpless, K. Barry Journal of Organic Chemistry, 1984 , vol. 49, # 20 p. 3861 - 3862 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| (S,S)-(-)-N,N inverted exclamation marka-Bis(|A-methylbenzyl)sulfamide |
| (S,S)-(-)-N,N'-Bis(1-phenylethyl)sulfamide |
| MFCD00064477 |
| (S,S)-(-)-N,N inverted exclamation marka-Bis(1-phenylethyl)sulfamide |