L-Aspartic acid-L-lysine (1:1) structure
|
Common Name | L-Aspartic acid-L-lysine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 27348-32-9 | Molecular Weight | 279.290 | |
| Density | N/A | Boiling Point | 516.6ºC at 760 mmHg | |
| Molecular Formula | C10H21N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2S)-2-aminobutanedioic acid,(2S)-2,6-diaminohexanoic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 516.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C10H21N3O6 |
| Molecular Weight | 279.290 |
| Exact Mass | 279.143036 |
| PSA | 189.96000 |
| LogP | 0.50120 |
| InChIKey | CPYVQXAASIFAMD-KNIFDHDWSA-N |
| SMILES | NC(CC(=O)O)C(=O)O.NCCCCC(N)C(=O)O |
| Storage condition | -20°C |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S24/25 |
| WGK Germany | 3 |
| HS Code | 29181300 |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Asparaginsaeure |
| EINECS 248-423-1 |
| L-Lysine aspartate |
| Lysine aspartate |
| L-Aspartic acid, compd. with L-lysine (1:1) |
| L-Lysine L-aspartate |
| L-Aspartic acid - L-lysine (1:1) |
| MFCD00058085 |
| (S)-2,6-Diaminohexanoic acid compound with (S)-2-aminosuccinic acid (1:1) |
| L-Lysine-L-aspartate |