2-Bromophenanthridone structure
|
Common Name | 2-Bromophenanthridone | ||
|---|---|---|---|---|
| CAS Number | 27353-48-6 | Molecular Weight | 274.11300 | |
| Density | 1.568g/cm3 | Boiling Point | 321.6ºC at 760 mmHg | |
| Molecular Formula | C13H8BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.3ºC | |
| Name | 2-bromo-5H-phenanthridin-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.568g/cm3 |
|---|---|
| Boiling Point | 321.6ºC at 760 mmHg |
| Molecular Formula | C13H8BrNO |
| Molecular Weight | 274.11300 |
| Flash Point | 148.3ºC |
| Exact Mass | 272.97900 |
| PSA | 32.86000 |
| LogP | 3.44380 |
| Vapour Pressure | 0.000296mmHg at 25°C |
| Index of Refraction | 1.665 |
| InChIKey | OJWSCRAZKRSYIB-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c2ccc(Br)cc2c2ccccc12 |
| HS Code | 2933990090 |
|---|
|
~70%
2-Bromophenanth... CAS#:27353-48-6 |
| Literature: Patil, Shivaputra; Kamath, Shantaram; Sanchez, Tino; Neamati, Nouri; Schinazi, Raymond F.; Buolamwini, John K. Bioorganic and Medicinal Chemistry, 2007 , vol. 15, # 3 p. 1212 - 1228 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Bromophenanthridone |