2(1H)-Pyrimidinone,6-amino-5-nitro structure
|
Common Name | 2(1H)-Pyrimidinone,6-amino-5-nitro | ||
|---|---|---|---|---|
| CAS Number | 69099-99-6 | Molecular Weight | 156.10000 | |
| Density | 2.02g/cm3 | Boiling Point | 553.4ºC at 760 mmHg | |
| Molecular Formula | C4H4N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 288.5ºC | |
| Name | 6-amino-5-nitro-1H-pyrimidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 2.02g/cm3 |
|---|---|
| Boiling Point | 553.4ºC at 760 mmHg |
| Molecular Formula | C4H4N4O3 |
| Molecular Weight | 156.10000 |
| Flash Point | 288.5ºC |
| Exact Mass | 156.02800 |
| PSA | 117.59000 |
| LogP | 0.36470 |
| Index of Refraction | 1.798 |
| InChIKey | SPDBZGFVYQCVIU-UHFFFAOYSA-N |
| SMILES | Nc1[nH]c(=O)ncc1[N+](=O)[O-] |
|
~90%
2(1H)-Pyrimidin... CAS#:69099-99-6 |
| Literature: Mittapalli, Gopi Kumar; Osornio, Yazmin M.; Guerrero, Miguel A.; Reddy, Kondreddi Ravinder; Krishnamurthy, Ramanarayanan; Eschenmoser, Albert Angewandte Chemie - International Edition, 2007 , vol. 46, # 14 p. 2478 - 2484 |
|
~%
2(1H)-Pyrimidin... CAS#:69099-99-6 |
| Literature: Johnson; Johns; Heyl American Chemical Journal, 1906 , vol. 36, p. 176 |
|
~%
2(1H)-Pyrimidin... CAS#:69099-99-6 |
| Literature: Brown Journal of the Chemical Society, 1959 , p. 3647 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 4-amino-5-nitropyrimidin-2(1H)-one |
| 6-Amino-5-nitro-2(1H)-pyrimidine |
| 5-Nitrocytosine |
| 4-Amino-5-nitro-2(1H)-pyrimidinone |
| 5-Nitro-cytosin |
| 4-amino-5-nitro-1H-pyrimidin-2-one |
| 4-Amino-5-nitro-1H-pyrimidin-2-on |